C19H13BrN4O3 — CID 56807074
3-(10-bromo-2-oxo-3-phenyl-[1,2,4]triazino[2,3-c]quinazolin-6-yl)propanoic acid (PubChem CID 56807074) has the molecular formula C19H13BrN4O3 and a molecular weight of 425.24 g/mol. Its IUPAC name is 3-(10-bromo-2-oxo-3-phenyl-[1,2,4]triazino[2,3-c]quinazolin-6-yl)propanoic acid.
| Compound Name | 3-(10-bromo-2-oxo-3-phenyl-[1,2,4]triazino[2,3-c]quinazolin-6-yl)propanoic acid |
|---|---|
| PubChem CID | 56807074 |
| Molecular Formula | C19H13BrN4O3 |
| Molecular Weight | 425.24 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 3-(10-bromo-2-oxo-3-phenyl-[1,2,4]triazino[2,3-c]quinazolin-6-yl)propanoic acid |
| SMILES | O=C(O)CCc1nc2ccc(Br)cc2c2nc(=O)c(-c3ccccc3)nn12 |
| InChI | InChI=1S/C19H13BrN4O3/c20-12-6-7-14-13(10-12)18-22-19(27)17(11-4-2-1-3-5-11)23-24(18)15(21-14)8-9-16(25)26/h1-7,10H,8-9H2,(H,25,26) |
| InChIKey | REOZMLFKGVXPDD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|