About [1-(2,5-dimethylphenyl)sulfonylcyclopentyl]-piperidin-1-ylmethanone
[1-(2,5-dimethylphenyl)sulfonylcyclopentyl]-piperidin-1-ylmethanone (PubChem CID 56807459) has the molecular formula C19H27NO3S
and a molecular weight of 349.50 g/mol. Its IUPAC name is [1-(2,5-dimethylphenyl)sulfonylcyclopentyl]-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | [1-(2,5-dimethylphenyl)sulfonylcyclopentyl]-piperidin-1-ylmethanone |
| PubChem CID | 56807459 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | [1-(2,5-dimethylphenyl)sulfonylcyclopentyl]-piperidin-1-ylmethanone |
| SMILES | Cc1ccc(C)c(S(=O)(=O)C2(C(=O)N3CCCCC3)CCCC2)c1 |
| InChI | InChI=1S/C19H27NO3S/c1-15-8-9-16(2)17(14-15)24(22,23)19(10-4-5-11-19)18(21)20-12-6-3-7-13-20/h8-9,14H,3-7,10-13H2,1-2H3 |
| InChIKey | ZUPQUWXTRVCQFM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(2,5-dimethylphenyl)sulfonylcyclopentyl]-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,5-dimethylphenyl)sulfonylcyclopentyl]-piperidin-1-ylmethanone?
The IUPAC name of [1-(2,5-dimethylphenyl)sulfonylcyclopentyl]-piperidin-1-ylmethanone (CID 56807459) is [1-(2,5-dimethylphenyl)sulfonylcyclopentyl]-piperidin-1-ylmethanone.
What is the SMILES notation for [1-(2,5-dimethylphenyl)sulfonylcyclopentyl]-piperidin-1-ylmethanone?
The canonical SMILES for [1-(2,5-dimethylphenyl)sulfonylcyclopentyl]-piperidin-1-ylmethanone is Cc1ccc(C)c(S(=O)(=O)C2(C(=O)N3CCCCC3)CCCC2)c1.
What is the InChIKey of [1-(2,5-dimethylphenyl)sulfonylcyclopentyl]-piperidin-1-ylmethanone?
The InChIKey is ZUPQUWXTRVCQFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO3S/c1-15-8-9-16(2)17(14-15)24(22,23)19(10-4-5-11-19)18(21)20-12-6-3-7-13-20/h8-9,14H,3-7,10-13H2,1-2H3.
What are the key properties of [1-(2,5-dimethylphenyl)sulfonylcyclopentyl]-piperidin-1-ylmethanone?
[1-(2,5-dimethylphenyl)sulfonylcyclopentyl]-piperidin-1-ylmethanone has a molecular weight of 349.50 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,5-dimethylphenyl)sulfonylcyclopentyl]-piperidin-1-ylmethanone is sourced from PubChem (CID 56807459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).