C16H19FN4O2 — CID 56807656
N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-4-fluoro-1H-indole-2-carboxamide (PubChem CID 56807656) has the molecular formula C16H19FN4O2 and a molecular weight of 318.35 g/mol. Its IUPAC name is N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-4-fluoro-1H-indole-2-carboxamide.
| Compound Name | N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-4-fluoro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 56807656 |
| Molecular Formula | C16H19FN4O2 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-4-fluoro-1H-indole-2-carboxamide |
| SMILES | NC(=O)CN1CCC(NC(=O)c2cc3c(F)cccc3[nH]2)CC1 |
| InChI | InChI=1S/C16H19FN4O2/c17-12-2-1-3-13-11(12)8-14(20-13)16(23)19-10-4-6-21(7-5-10)9-15(18)22/h1-3,8,10,20H,4-7,9H2,(H2,18,22)(H,19,23) |
| InChIKey | QWOPFCLUVIQIRE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |