C13H20O4 — CID 568077
methyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methylidenecyclopentane-1-carboxylate (PubChem CID 568077) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is methyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methylidenecyclopentane-1-carboxylate.
| Compound Name | methyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methylidenecyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 568077 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | methyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methylidenecyclopentane-1-carboxylate |
| SMILES | C=C1CCC(C(=O)OC)C1C1COC(C)(C)O1 |
| InChI | InChI=1S/C13H20O4/c1-8-5-6-9(12(14)15-4)11(8)10-7-16-13(2,3)17-10/h9-11H,1,5-7H2,2-4H3 |
| InChIKey | YXRVKHGLGJSCFF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|