About 4-[[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]methyl]oxane-4-carboxamide
4-[[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]methyl]oxane-4-carboxamide (PubChem CID 56808466) has the molecular formula C15H24N4O3
and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-[[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]methyl]oxane-4-carboxamide.
Molecular Properties
| Compound Name | 4-[[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]methyl]oxane-4-carboxamide |
| PubChem CID | 56808466 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 4-[[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]methyl]oxane-4-carboxamide |
| SMILES | Cc1nn(C)c(C)c1CC(=O)NCC1(C(N)=O)CCOCC1 |
| InChI | InChI=1S/C15H24N4O3/c1-10-12(11(2)19(3)18-10)8-13(20)17-9-15(14(16)21)4-6-22-7-5-15/h4-9H2,1-3H3,(H2,16,21)(H,17,20) |
| InChIKey | UOVPZSHHJRUYHJ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]methyl]oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]methyl]oxane-4-carboxamide?
The IUPAC name of 4-[[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]methyl]oxane-4-carboxamide (CID 56808466) is 4-[[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]methyl]oxane-4-carboxamide.
What is the SMILES notation for 4-[[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]methyl]oxane-4-carboxamide?
The canonical SMILES for 4-[[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]methyl]oxane-4-carboxamide is Cc1nn(C)c(C)c1CC(=O)NCC1(C(N)=O)CCOCC1.
What is the InChIKey of 4-[[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]methyl]oxane-4-carboxamide?
The InChIKey is UOVPZSHHJRUYHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4O3/c1-10-12(11(2)19(3)18-10)8-13(20)17-9-15(14(16)21)4-6-22-7-5-15/h4-9H2,1-3H3,(H2,16,21)(H,17,20).
What are the key properties of 4-[[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]methyl]oxane-4-carboxamide?
4-[[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]methyl]oxane-4-carboxamide has a molecular weight of 308.38 g/mol, XLogP of -0.02, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]methyl]oxane-4-carboxamide is sourced from PubChem (CID 56808466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).