C18H24N4 — CID 56809171
1-[(2-phenyltriazol-4-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 56809171) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is 1-[(2-phenyltriazol-4-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-[(2-phenyltriazol-4-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 56809171 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 1-[(2-phenyltriazol-4-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | c1ccc(-n2ncc(CN3CCCC4CCCCC43)n2)cc1 |
| InChI | InChI=1S/C18H24N4/c1-2-9-17(10-3-1)22-19-13-16(20-22)14-21-12-6-8-15-7-4-5-11-18(15)21/h1-3,9-10,13,15,18H,4-8,11-12,14H2 |
| InChIKey | LYXTWSAOPMYMMF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |