C13H17ClN2O3S — CID 56809657
1-[2-(4-chlorophenyl)sulfonylethyl]-1,4-diazepan-5-one (PubChem CID 56809657) has the molecular formula C13H17ClN2O3S and a molecular weight of 316.81 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfonylethyl]-1,4-diazepan-5-one.
| Compound Name | 1-[2-(4-chlorophenyl)sulfonylethyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 56809657 |
| Molecular Formula | C13H17ClN2O3S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfonylethyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCN(CCS(=O)(=O)c2ccc(Cl)cc2)CCN1 |
| InChI | InChI=1S/C13H17ClN2O3S/c14-11-1-3-12(4-2-11)20(18,19)10-9-16-7-5-13(17)15-6-8-16/h1-4H,5-10H2,(H,15,17) |
| InChIKey | UZPGCYNCBJVBRA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |