About 1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one
1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one (PubChem CID 56809674) has the molecular formula C13H18N2O5S2
and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one |
| PubChem CID | 56809674 |
| Molecular Formula | C13H18N2O5S2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one |
| SMILES | CS(=O)(=O)c1ccc(N2CCNC(=O)CC2)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H18N2O5S2/c1-21(17,18)10-3-4-11(12(9-10)22(2,19)20)15-7-5-13(16)14-6-8-15/h3-4,9H,5-8H2,1-2H3,(H,14,16) |
| InChIKey | PDHZSINPSSUZPO-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one?
The IUPAC name of 1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one (CID 56809674) is 1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one.
What is the SMILES notation for 1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one?
The canonical SMILES for 1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one is CS(=O)(=O)c1ccc(N2CCNC(=O)CC2)c(S(C)(=O)=O)c1.
What is the InChIKey of 1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one?
The InChIKey is PDHZSINPSSUZPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O5S2/c1-21(17,18)10-3-4-11(12(9-10)22(2,19)20)15-7-5-13(16)14-6-8-15/h3-4,9H,5-8H2,1-2H3,(H,14,16).
What are the key properties of 1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one?
1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one has a molecular weight of 346.43 g/mol, XLogP of -0.18, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one is sourced from PubChem (CID 56809674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).