C13H18N2O5S2 — CID 56809674
1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one (PubChem CID 56809674) has the molecular formula C13H18N2O5S2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one.
| Compound Name | 1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 56809674 |
| Molecular Formula | C13H18N2O5S2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 1-[2,4-bis(methylsulfonyl)phenyl]-1,4-diazepan-5-one |
| SMILES | CS(=O)(=O)c1ccc(N2CCNC(=O)CC2)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H18N2O5S2/c1-21(17,18)10-3-4-11(12(9-10)22(2,19)20)15-7-5-13(16)14-6-8-15/h3-4,9H,5-8H2,1-2H3,(H,14,16) |
| InChIKey | PDHZSINPSSUZPO-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |