C15H19N5O5 — CID 56809748
8-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 56809748) has the molecular formula C15H19N5O5 and a molecular weight of 349.35 g/mol. Its IUPAC name is 8-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 56809748 |
| Molecular Formula | C15H19N5O5 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 8-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)N1CCC2(CC1)NC(=O)NC2=O |
| InChI | InChI=1S/C15H19N5O5/c1-8-9(11(22)17-13(24)16-8)2-3-10(21)20-6-4-15(5-7-20)12(23)18-14(25)19-15/h2-7H2,1H3,(H2,16,17,22,24)(H2,18,19,23,25) |
| InChIKey | CBSXACIHOASEOI-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 144.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|