C18H20N2O4 — CID 56810298
(E)-3-[4-(2-amino-2-oxoethoxy)phenyl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]prop-2-enamide (PubChem CID 56810298) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is (E)-3-[4-(2-amino-2-oxoethoxy)phenyl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(2-amino-2-oxoethoxy)phenyl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 56810298 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (E)-3-[4-(2-amino-2-oxoethoxy)phenyl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]prop-2-enamide |
| SMILES | Cc1ccc(CN(C)C(=O)/C=C/c2ccc(OCC(N)=O)cc2)o1 |
| InChI | InChI=1S/C18H20N2O4/c1-13-3-7-16(24-13)11-20(2)18(22)10-6-14-4-8-15(9-5-14)23-12-17(19)21/h3-10H,11-12H2,1-2H3,(H2,19,21)/b10-6+ |
| InChIKey | BCRHNWNEYZQQIH-UXBLZVDNSA-N |
| XLogP | 2.12 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|