About 2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline
2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 56810315) has the molecular formula C11H12N2OS
and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline.
Molecular Properties
| Compound Name | 2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
| PubChem CID | 56810315 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | COc1ccccc1NCc1cscn1 |
| InChI | InChI=1S/C11H12N2OS/c1-14-11-5-3-2-4-10(11)12-6-9-7-15-8-13-9/h2-5,7-8,12H,6H2,1H3 |
| InChIKey | UTVJQDZFBFAWFD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline?
The IUPAC name of 2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline (CID 56810315) is 2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline.
What is the SMILES notation for 2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline?
The canonical SMILES for 2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline is COc1ccccc1NCc1cscn1.
What is the InChIKey of 2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline?
The InChIKey is UTVJQDZFBFAWFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2OS/c1-14-11-5-3-2-4-10(11)12-6-9-7-15-8-13-9/h2-5,7-8,12H,6H2,1H3.
What are the key properties of 2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline?
2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline has a molecular weight of 220.30 g/mol, XLogP of 2.76, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline is sourced from PubChem (CID 56810315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).