About N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4-ethylpiperazine-1-carboxamide
N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4-ethylpiperazine-1-carboxamide (PubChem CID 56810650) has the molecular formula C15H24N4O2
and a molecular weight of 292.38 g/mol. Its IUPAC name is N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4-ethylpiperazine-1-carboxamide.
Molecular Properties
| Compound Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4-ethylpiperazine-1-carboxamide |
| PubChem CID | 56810650 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4-ethylpiperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)NCc2c(C)cc(C)[nH]c2=O)CC1 |
| InChI | InChI=1S/C15H24N4O2/c1-4-18-5-7-19(8-6-18)15(21)16-10-13-11(2)9-12(3)17-14(13)20/h9H,4-8,10H2,1-3H3,(H,16,21)(H,17,20) |
| InChIKey | FYOWIJWSYXKKDN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4-ethylpiperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4-ethylpiperazine-1-carboxamide?
The IUPAC name of N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4-ethylpiperazine-1-carboxamide (CID 56810650) is N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4-ethylpiperazine-1-carboxamide.
What is the SMILES notation for N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4-ethylpiperazine-1-carboxamide?
The canonical SMILES for N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4-ethylpiperazine-1-carboxamide is CCN1CCN(C(=O)NCc2c(C)cc(C)[nH]c2=O)CC1.
What is the InChIKey of N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4-ethylpiperazine-1-carboxamide?
The InChIKey is FYOWIJWSYXKKDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4O2/c1-4-18-5-7-19(8-6-18)15(21)16-10-13-11(2)9-12(3)17-14(13)20/h9H,4-8,10H2,1-3H3,(H,16,21)(H,17,20).
What are the key properties of N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4-ethylpiperazine-1-carboxamide?
N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4-ethylpiperazine-1-carboxamide has a molecular weight of 292.38 g/mol, XLogP of 0.84, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4-ethylpiperazine-1-carboxamide is sourced from PubChem (CID 56810650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).