C17H22N2O3 — CID 56811485
3-[2-(4-benzoylpiperidin-1-yl)ethyl]-1,3-oxazolidin-2-one (PubChem CID 56811485) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-[2-(4-benzoylpiperidin-1-yl)ethyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-(4-benzoylpiperidin-1-yl)ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 56811485 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 3-[2-(4-benzoylpiperidin-1-yl)ethyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(c1ccccc1)C1CCN(CCN2CCOC2=O)CC1 |
| InChI | InChI=1S/C17H22N2O3/c20-16(14-4-2-1-3-5-14)15-6-8-18(9-7-15)10-11-19-12-13-22-17(19)21/h1-5,15H,6-13H2 |
| InChIKey | VLXJOTPLIYRZOA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |