C19H17FN2O — CID 56811633
N-[1-(4-cyanophenyl)ethyl]-1-(4-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 56811633) has the molecular formula C19H17FN2O and a molecular weight of 308.36 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)ethyl]-1-(4-fluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[1-(4-cyanophenyl)ethyl]-1-(4-fluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 56811633 |
| Molecular Formula | C19H17FN2O |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-[1-(4-cyanophenyl)ethyl]-1-(4-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | CC(NC(=O)C1(c2ccc(F)cc2)CC1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H17FN2O/c1-13(15-4-2-14(12-21)3-5-15)22-18(23)19(10-11-19)16-6-8-17(20)9-7-16/h2-9,13H,10-11H2,1H3,(H,22,23) |
| InChIKey | OODCTBFFBAKJKU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |