About 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride
1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride (PubChem CID 56811860) has the molecular formula C8H16ClN3O
and a molecular weight of 205.69 g/mol. Its IUPAC name is 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride |
| PubChem CID | 56811860 |
| Molecular Formula | C8H16ClN3O |
| Molecular Weight | 205.69 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride |
| SMILES | CC(N)c1nc(C(C)(C)C)no1.Cl |
| InChI | InChI=1S/C8H15N3O.ClH/c1-5(9)6-10-7(11-12-6)8(2,3)4;/h5H,9H2,1-4H3;1H |
| InChIKey | HFVKQKKEACYYLQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.69 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride?
The IUPAC name of 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride (CID 56811860) is 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride.
What is the SMILES notation for 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride?
The canonical SMILES for 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride is CC(N)c1nc(C(C)(C)C)no1.Cl.
What is the InChIKey of 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride?
The InChIKey is HFVKQKKEACYYLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O.ClH/c1-5(9)6-10-7(11-12-6)8(2,3)4;/h5H,9H2,1-4H3;1H.
What are the key properties of 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride?
1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride has a molecular weight of 205.69 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride is sourced from PubChem (CID 56811860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).