About (5-chloro-2,3-dihydro-1-benzofuran-2-yl)-thiomorpholin-4-ylmethanone
(5-chloro-2,3-dihydro-1-benzofuran-2-yl)-thiomorpholin-4-ylmethanone (PubChem CID 56813512) has the molecular formula C13H14ClNO2S
and a molecular weight of 283.78 g/mol. Its IUPAC name is (5-chloro-2,3-dihydro-1-benzofuran-2-yl)-thiomorpholin-4-ylmethanone.
Molecular Properties
| Compound Name | (5-chloro-2,3-dihydro-1-benzofuran-2-yl)-thiomorpholin-4-ylmethanone |
| PubChem CID | 56813512 |
| Molecular Formula | C13H14ClNO2S |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | (5-chloro-2,3-dihydro-1-benzofuran-2-yl)-thiomorpholin-4-ylmethanone |
| SMILES | O=C(C1Cc2cc(Cl)ccc2O1)N1CCSCC1 |
| InChI | InChI=1S/C13H14ClNO2S/c14-10-1-2-11-9(7-10)8-12(17-11)13(16)15-3-5-18-6-4-15/h1-2,7,12H,3-6,8H2 |
| InChIKey | PDIZFZXFICYYNH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-chloro-2,3-dihydro-1-benzofuran-2-yl)-thiomorpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-2,3-dihydro-1-benzofuran-2-yl)-thiomorpholin-4-ylmethanone?
The IUPAC name of (5-chloro-2,3-dihydro-1-benzofuran-2-yl)-thiomorpholin-4-ylmethanone (CID 56813512) is (5-chloro-2,3-dihydro-1-benzofuran-2-yl)-thiomorpholin-4-ylmethanone.
What is the SMILES notation for (5-chloro-2,3-dihydro-1-benzofuran-2-yl)-thiomorpholin-4-ylmethanone?
The canonical SMILES for (5-chloro-2,3-dihydro-1-benzofuran-2-yl)-thiomorpholin-4-ylmethanone is O=C(C1Cc2cc(Cl)ccc2O1)N1CCSCC1.
What is the InChIKey of (5-chloro-2,3-dihydro-1-benzofuran-2-yl)-thiomorpholin-4-ylmethanone?
The InChIKey is PDIZFZXFICYYNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClNO2S/c14-10-1-2-11-9(7-10)8-12(17-11)13(16)15-3-5-18-6-4-15/h1-2,7,12H,3-6,8H2.
What are the key properties of (5-chloro-2,3-dihydro-1-benzofuran-2-yl)-thiomorpholin-4-ylmethanone?
(5-chloro-2,3-dihydro-1-benzofuran-2-yl)-thiomorpholin-4-ylmethanone has a molecular weight of 283.78 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-2,3-dihydro-1-benzofuran-2-yl)-thiomorpholin-4-ylmethanone is sourced from PubChem (CID 56813512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).