About 1-[4-(2-piperidin-1-ylpyridine-3-carbonyl)-1,4-diazepan-1-yl]ethanone
1-[4-(2-piperidin-1-ylpyridine-3-carbonyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 56813825) has the molecular formula C18H26N4O2
and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-[4-(2-piperidin-1-ylpyridine-3-carbonyl)-1,4-diazepan-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(2-piperidin-1-ylpyridine-3-carbonyl)-1,4-diazepan-1-yl]ethanone |
| PubChem CID | 56813825 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 1-[4-(2-piperidin-1-ylpyridine-3-carbonyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(C(=O)c2cccnc2N2CCCCC2)CC1 |
| InChI | InChI=1S/C18H26N4O2/c1-15(23)20-11-6-12-22(14-13-20)18(24)16-7-5-8-19-17(16)21-9-3-2-4-10-21/h5,7-8H,2-4,6,9-14H2,1H3 |
| InChIKey | FUEZSRYXMVHPEP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(2-piperidin-1-ylpyridine-3-carbonyl)-1,4-diazepan-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2-piperidin-1-ylpyridine-3-carbonyl)-1,4-diazepan-1-yl]ethanone?
The IUPAC name of 1-[4-(2-piperidin-1-ylpyridine-3-carbonyl)-1,4-diazepan-1-yl]ethanone (CID 56813825) is 1-[4-(2-piperidin-1-ylpyridine-3-carbonyl)-1,4-diazepan-1-yl]ethanone.
What is the SMILES notation for 1-[4-(2-piperidin-1-ylpyridine-3-carbonyl)-1,4-diazepan-1-yl]ethanone?
The canonical SMILES for 1-[4-(2-piperidin-1-ylpyridine-3-carbonyl)-1,4-diazepan-1-yl]ethanone is CC(=O)N1CCCN(C(=O)c2cccnc2N2CCCCC2)CC1.
What is the InChIKey of 1-[4-(2-piperidin-1-ylpyridine-3-carbonyl)-1,4-diazepan-1-yl]ethanone?
The InChIKey is FUEZSRYXMVHPEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N4O2/c1-15(23)20-11-6-12-22(14-13-20)18(24)16-7-5-8-19-17(16)21-9-3-2-4-10-21/h5,7-8H,2-4,6,9-14H2,1H3.
What are the key properties of 1-[4-(2-piperidin-1-ylpyridine-3-carbonyl)-1,4-diazepan-1-yl]ethanone?
1-[4-(2-piperidin-1-ylpyridine-3-carbonyl)-1,4-diazepan-1-yl]ethanone has a molecular weight of 330.43 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2-piperidin-1-ylpyridine-3-carbonyl)-1,4-diazepan-1-yl]ethanone is sourced from PubChem (CID 56813825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).