About 4-(butan-2-ylcarbamoylamino)-N,N-diethylbutanamide
4-(butan-2-ylcarbamoylamino)-N,N-diethylbutanamide (PubChem CID 56813964) has the molecular formula C13H27N3O2
and a molecular weight of 257.38 g/mol. Its IUPAC name is 4-(butan-2-ylcarbamoylamino)-N,N-diethylbutanamide.
Molecular Properties
| Compound Name | 4-(butan-2-ylcarbamoylamino)-N,N-diethylbutanamide |
| PubChem CID | 56813964 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 4-(butan-2-ylcarbamoylamino)-N,N-diethylbutanamide |
| SMILES | CCC(C)NC(=O)NCCCC(=O)N(CC)CC |
| InChI | InChI=1S/C13H27N3O2/c1-5-11(4)15-13(18)14-10-8-9-12(17)16(6-2)7-3/h11H,5-10H2,1-4H3,(H2,14,15,18) |
| InChIKey | AHDGDBDUWXAFJK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(butan-2-ylcarbamoylamino)-N,N-diethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(butan-2-ylcarbamoylamino)-N,N-diethylbutanamide?
The IUPAC name of 4-(butan-2-ylcarbamoylamino)-N,N-diethylbutanamide (CID 56813964) is 4-(butan-2-ylcarbamoylamino)-N,N-diethylbutanamide.
What is the SMILES notation for 4-(butan-2-ylcarbamoylamino)-N,N-diethylbutanamide?
The canonical SMILES for 4-(butan-2-ylcarbamoylamino)-N,N-diethylbutanamide is CCC(C)NC(=O)NCCCC(=O)N(CC)CC.
What is the InChIKey of 4-(butan-2-ylcarbamoylamino)-N,N-diethylbutanamide?
The InChIKey is AHDGDBDUWXAFJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O2/c1-5-11(4)15-13(18)14-10-8-9-12(17)16(6-2)7-3/h11H,5-10H2,1-4H3,(H2,14,15,18).
What are the key properties of 4-(butan-2-ylcarbamoylamino)-N,N-diethylbutanamide?
4-(butan-2-ylcarbamoylamino)-N,N-diethylbutanamide has a molecular weight of 257.38 g/mol, XLogP of 1.73, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(butan-2-ylcarbamoylamino)-N,N-diethylbutanamide is sourced from PubChem (CID 56813964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).