C18H25ClN4O — CID 56814037
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(5-chloro-2-pyrrolidin-1-ylpyrimidin-4-yl)methanone (PubChem CID 56814037) has the molecular formula C18H25ClN4O and a molecular weight of 348.88 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(5-chloro-2-pyrrolidin-1-ylpyrimidin-4-yl)methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(5-chloro-2-pyrrolidin-1-ylpyrimidin-4-yl)methanone |
|---|---|
| PubChem CID | 56814037 |
| Molecular Formula | C18H25ClN4O |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(5-chloro-2-pyrrolidin-1-ylpyrimidin-4-yl)methanone |
| SMILES | O=C(c1nc(N2CCCC2)ncc1Cl)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C18H25ClN4O/c19-14-12-20-18(22-9-3-4-10-22)21-16(14)17(24)23-11-5-7-13-6-1-2-8-15(13)23/h12-13,15H,1-11H2 |
| InChIKey | IBMUMKVNKOEOGU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |