C11H10F6N2O3 — CID 56814265
N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 56814265) has the molecular formula C11H10F6N2O3 and a molecular weight of 332.20 g/mol. Its IUPAC name is N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 56814265 |
| Molecular Formula | C11H10F6N2O3 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | O=C(CCOCC(F)(F)F)Nc1cc(C(F)(F)F)c[nH]c1=O |
| InChI | InChI=1S/C11H10F6N2O3/c12-10(13,14)5-22-2-1-8(20)19-7-3-6(11(15,16)17)4-18-9(7)21/h3-4H,1-2,5H2,(H,18,21)(H,19,20) |
| InChIKey | RDPXUTAVLOKXAI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|