C18H28N4O2 — CID 56814486
1-[2-(2-methylpropylamino)-2-oxoethyl]-N-(6-methyl-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 56814486) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-[2-(2-methylpropylamino)-2-oxoethyl]-N-(6-methyl-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | 1-[2-(2-methylpropylamino)-2-oxoethyl]-N-(6-methyl-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56814486 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 1-[2-(2-methylpropylamino)-2-oxoethyl]-N-(6-methyl-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)C2CCCN(CC(=O)NCC(C)C)C2)n1 |
| InChI | InChI=1S/C18H28N4O2/c1-13(2)10-19-17(23)12-22-9-5-7-15(11-22)18(24)21-16-8-4-6-14(3)20-16/h4,6,8,13,15H,5,7,9-12H2,1-3H3,(H,19,23)(H,20,21,24) |
| InChIKey | BBLIPVQVULLAJM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |