C17H21ClN4O — CID 56814864
N-[(5-chloro-2-methoxyphenyl)methyl]-1-pyrimidin-2-ylpiperidin-4-amine (PubChem CID 56814864) has the molecular formula C17H21ClN4O and a molecular weight of 332.83 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]-1-pyrimidin-2-ylpiperidin-4-amine.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]-1-pyrimidin-2-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 56814864 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]-1-pyrimidin-2-ylpiperidin-4-amine |
| SMILES | COc1ccc(Cl)cc1CNC1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H21ClN4O/c1-23-16-4-3-14(18)11-13(16)12-21-15-5-9-22(10-6-15)17-19-7-2-8-20-17/h2-4,7-8,11,15,21H,5-6,9-10,12H2,1H3 |
| InChIKey | LFAHXZGCMAMYBM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |