C15H16F2N2O3 — CID 56815008
2-[2-(2,4-difluorophenyl)-2-hydroxyethyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione (PubChem CID 56815008) has the molecular formula C15H16F2N2O3 and a molecular weight of 310.30 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)-2-hydroxyethyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione.
| Compound Name | 2-[2-(2,4-difluorophenyl)-2-hydroxyethyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
|---|---|
| PubChem CID | 56815008 |
| Molecular Formula | C15H16F2N2O3 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)-2-hydroxyethyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
| SMILES | O=C1C2CCCCN2C(=O)N1CC(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H16F2N2O3/c16-9-4-5-10(11(17)7-9)13(20)8-19-14(21)12-3-1-2-6-18(12)15(19)22/h4-5,7,12-13,20H,1-3,6,8H2 |
| InChIKey | PRMFRUQSQWKRHM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|