C16H27N3O3 — CID 56815229
2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-N-(2-oxoazepan-3-yl)acetamide (PubChem CID 56815229) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-N-(2-oxoazepan-3-yl)acetamide.
| Compound Name | 2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-N-(2-oxoazepan-3-yl)acetamide |
|---|---|
| PubChem CID | 56815229 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-N-(2-oxoazepan-3-yl)acetamide |
| SMILES | O=C(CN1CCOC2CCCCC21)NC1CCCCNC1=O |
| InChI | InChI=1S/C16H27N3O3/c20-15(18-12-5-3-4-8-17-16(12)21)11-19-9-10-22-14-7-2-1-6-13(14)19/h12-14H,1-11H2,(H,17,21)(H,18,20) |
| InChIKey | VUOSXWINTURMRF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |