About 1,6-dimethyl-4-(2-phenylpyrrolidin-1-yl)pyrazolo[5,4-d]pyrimidine
1,6-dimethyl-4-(2-phenylpyrrolidin-1-yl)pyrazolo[5,4-d]pyrimidine (PubChem CID 56816112) has the molecular formula C17H19N5
and a molecular weight of 293.37 g/mol. Its IUPAC name is 1,6-dimethyl-4-(2-phenylpyrrolidin-1-yl)pyrazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 1,6-dimethyl-4-(2-phenylpyrrolidin-1-yl)pyrazolo[5,4-d]pyrimidine |
| PubChem CID | 56816112 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 1,6-dimethyl-4-(2-phenylpyrrolidin-1-yl)pyrazolo[5,4-d]pyrimidine |
| SMILES | Cc1nc(N2CCCC2c2ccccc2)c2cnn(C)c2n1 |
| InChI | InChI=1S/C17H19N5/c1-12-19-16-14(11-18-21(16)2)17(20-12)22-10-6-9-15(22)13-7-4-3-5-8-13/h3-5,7-8,11,15H,6,9-10H2,1-2H3 |
| InChIKey | KYZKPBZFUCJFDQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,6-dimethyl-4-(2-phenylpyrrolidin-1-yl)pyrazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-4-(2-phenylpyrrolidin-1-yl)pyrazolo[5,4-d]pyrimidine?
The IUPAC name of 1,6-dimethyl-4-(2-phenylpyrrolidin-1-yl)pyrazolo[5,4-d]pyrimidine (CID 56816112) is 1,6-dimethyl-4-(2-phenylpyrrolidin-1-yl)pyrazolo[5,4-d]pyrimidine.
What is the SMILES notation for 1,6-dimethyl-4-(2-phenylpyrrolidin-1-yl)pyrazolo[5,4-d]pyrimidine?
The canonical SMILES for 1,6-dimethyl-4-(2-phenylpyrrolidin-1-yl)pyrazolo[5,4-d]pyrimidine is Cc1nc(N2CCCC2c2ccccc2)c2cnn(C)c2n1.
What is the InChIKey of 1,6-dimethyl-4-(2-phenylpyrrolidin-1-yl)pyrazolo[5,4-d]pyrimidine?
The InChIKey is KYZKPBZFUCJFDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5/c1-12-19-16-14(11-18-21(16)2)17(20-12)22-10-6-9-15(22)13-7-4-3-5-8-13/h3-5,7-8,11,15H,6,9-10H2,1-2H3.
What are the key properties of 1,6-dimethyl-4-(2-phenylpyrrolidin-1-yl)pyrazolo[5,4-d]pyrimidine?
1,6-dimethyl-4-(2-phenylpyrrolidin-1-yl)pyrazolo[5,4-d]pyrimidine has a molecular weight of 293.37 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-4-(2-phenylpyrrolidin-1-yl)pyrazolo[5,4-d]pyrimidine is sourced from PubChem (CID 56816112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).