C16H18ClN5O — CID 56816145
5-chloro-6-[(1-pyridin-2-ylpiperidin-4-yl)amino]pyridine-3-carboxamide (PubChem CID 56816145) has the molecular formula C16H18ClN5O and a molecular weight of 331.81 g/mol. Its IUPAC name is 5-chloro-6-[(1-pyridin-2-ylpiperidin-4-yl)amino]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-[(1-pyridin-2-ylpiperidin-4-yl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56816145 |
| Molecular Formula | C16H18ClN5O |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 5-chloro-6-[(1-pyridin-2-ylpiperidin-4-yl)amino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(NC2CCN(c3ccccn3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C16H18ClN5O/c17-13-9-11(15(18)23)10-20-16(13)21-12-4-7-22(8-5-12)14-3-1-2-6-19-14/h1-3,6,9-10,12H,4-5,7-8H2,(H2,18,23)(H,20,21) |
| InChIKey | FTOSUYFHBRKWNC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |