About 1-(4-methoxypiperidin-1-yl)-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone
1-(4-methoxypiperidin-1-yl)-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone (PubChem CID 56816199) has the molecular formula C15H18N4O2S
and a molecular weight of 318.40 g/mol. Its IUPAC name is 1-(4-methoxypiperidin-1-yl)-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-methoxypiperidin-1-yl)-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone |
| PubChem CID | 56816199 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-(4-methoxypiperidin-1-yl)-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone |
| SMILES | COC1CCN(C(=O)Cc2csc(-c3ncccn3)n2)CC1 |
| InChI | InChI=1S/C15H18N4O2S/c1-21-12-3-7-19(8-4-12)13(20)9-11-10-22-15(18-11)14-16-5-2-6-17-14/h2,5-6,10,12H,3-4,7-9H2,1H3 |
| InChIKey | MZDUIXMWFMCLDG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-methoxypiperidin-1-yl)-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxypiperidin-1-yl)-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone?
The IUPAC name of 1-(4-methoxypiperidin-1-yl)-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone (CID 56816199) is 1-(4-methoxypiperidin-1-yl)-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone.
What is the SMILES notation for 1-(4-methoxypiperidin-1-yl)-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone?
The canonical SMILES for 1-(4-methoxypiperidin-1-yl)-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone is COC1CCN(C(=O)Cc2csc(-c3ncccn3)n2)CC1.
What is the InChIKey of 1-(4-methoxypiperidin-1-yl)-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone?
The InChIKey is MZDUIXMWFMCLDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O2S/c1-21-12-3-7-19(8-4-12)13(20)9-11-10-22-15(18-11)14-16-5-2-6-17-14/h2,5-6,10,12H,3-4,7-9H2,1H3.
What are the key properties of 1-(4-methoxypiperidin-1-yl)-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone?
1-(4-methoxypiperidin-1-yl)-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone has a molecular weight of 318.40 g/mol, XLogP of 1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxypiperidin-1-yl)-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone is sourced from PubChem (CID 56816199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).