About 2-[1-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]piperidin-4-yl]acetamide
2-[1-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]piperidin-4-yl]acetamide (PubChem CID 56816591) has the molecular formula C16H21N3O3
and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[1-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]piperidin-4-yl]acetamide.
Molecular Properties
| Compound Name | 2-[1-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]piperidin-4-yl]acetamide |
| PubChem CID | 56816591 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-[1-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]piperidin-4-yl]acetamide |
| SMILES | Cc1ccc2oc(=O)n(CN3CCC(CC(N)=O)CC3)c2c1 |
| InChI | InChI=1S/C16H21N3O3/c1-11-2-3-14-13(8-11)19(16(21)22-14)10-18-6-4-12(5-7-18)9-15(17)20/h2-3,8,12H,4-7,9-10H2,1H3,(H2,17,20) |
| InChIKey | WAFUVMHCBBYGPO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]piperidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]piperidin-4-yl]acetamide?
The IUPAC name of 2-[1-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]piperidin-4-yl]acetamide (CID 56816591) is 2-[1-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]piperidin-4-yl]acetamide.
What is the SMILES notation for 2-[1-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]piperidin-4-yl]acetamide?
The canonical SMILES for 2-[1-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]piperidin-4-yl]acetamide is Cc1ccc2oc(=O)n(CN3CCC(CC(N)=O)CC3)c2c1.
What is the InChIKey of 2-[1-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]piperidin-4-yl]acetamide?
The InChIKey is WAFUVMHCBBYGPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O3/c1-11-2-3-14-13(8-11)19(16(21)22-14)10-18-6-4-12(5-7-18)9-15(17)20/h2-3,8,12H,4-7,9-10H2,1H3,(H2,17,20).
What are the key properties of 2-[1-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]piperidin-4-yl]acetamide?
2-[1-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]piperidin-4-yl]acetamide has a molecular weight of 303.36 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]piperidin-4-yl]acetamide is sourced from PubChem (CID 56816591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).