C13H11F2NO4S2 — CID 56816757
5-[(5-ethylthiophen-2-yl)sulfonylamino]-2,4-difluorobenzoic acid (PubChem CID 56816757) has the molecular formula C13H11F2NO4S2 and a molecular weight of 347.36 g/mol. Its IUPAC name is 5-[(5-ethylthiophen-2-yl)sulfonylamino]-2,4-difluorobenzoic acid.
| Compound Name | 5-[(5-ethylthiophen-2-yl)sulfonylamino]-2,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 56816757 |
| Molecular Formula | C13H11F2NO4S2 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 5-[(5-ethylthiophen-2-yl)sulfonylamino]-2,4-difluorobenzoic acid |
| SMILES | CCc1ccc(S(=O)(=O)Nc2cc(C(=O)O)c(F)cc2F)s1 |
| InChI | InChI=1S/C13H11F2NO4S2/c1-2-7-3-4-12(21-7)22(19,20)16-11-5-8(13(17)18)9(14)6-10(11)15/h3-6,16H,2H2,1H3,(H,17,18) |
| InChIKey | BNSDKPDWAWDYTH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |