About N-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]propanamide
N-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]propanamide (PubChem CID 56816928) has the molecular formula C8H13N5O2
and a molecular weight of 211.22 g/mol. Its IUPAC name is N-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]propanamide.
Molecular Properties
| Compound Name | N-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]propanamide |
| PubChem CID | 56816928 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | N-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]propanamide |
| SMILES | CNC(=O)C(C)NC(=O)Cn1cncn1 |
| InChI | InChI=1S/C8H13N5O2/c1-6(8(15)9-2)12-7(14)3-13-5-10-4-11-13/h4-6H,3H2,1-2H3,(H,9,15)(H,12,14) |
| InChIKey | TZUOKVMJKZQKRW-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]propanamide?
The IUPAC name of N-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]propanamide (CID 56816928) is N-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]propanamide.
What is the SMILES notation for N-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]propanamide?
The canonical SMILES for N-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]propanamide is CNC(=O)C(C)NC(=O)Cn1cncn1.
What is the InChIKey of N-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]propanamide?
The InChIKey is TZUOKVMJKZQKRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5O2/c1-6(8(15)9-2)12-7(14)3-13-5-10-4-11-13/h4-6H,3H2,1-2H3,(H,9,15)(H,12,14).
What are the key properties of N-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]propanamide?
N-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]propanamide has a molecular weight of 211.22 g/mol, XLogP of -1.47, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]propanamide is sourced from PubChem (CID 56816928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).