About [4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-(2-methylfuran-3-yl)methanone
[4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-(2-methylfuran-3-yl)methanone (PubChem CID 56817174) has the molecular formula C18H25N3O3
and a molecular weight of 331.42 g/mol. Its IUPAC name is [4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-(2-methylfuran-3-yl)methanone.
Molecular Properties
| Compound Name | [4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-(2-methylfuran-3-yl)methanone |
| PubChem CID | 56817174 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | [4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-(2-methylfuran-3-yl)methanone |
| SMILES | Cc1occc1C(=O)N1CCN(Cc2ncc(C(C)(C)C)o2)CC1 |
| InChI | InChI=1S/C18H25N3O3/c1-13-14(5-10-23-13)17(22)21-8-6-20(7-9-21)12-16-19-11-15(24-16)18(2,3)4/h5,10-11H,6-9,12H2,1-4H3 |
| InChIKey | QJASHHDNRAGCFW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 62.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-(2-methylfuran-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-(2-methylfuran-3-yl)methanone?
The IUPAC name of [4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-(2-methylfuran-3-yl)methanone (CID 56817174) is [4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-(2-methylfuran-3-yl)methanone.
What is the SMILES notation for [4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-(2-methylfuran-3-yl)methanone?
The canonical SMILES for [4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-(2-methylfuran-3-yl)methanone is Cc1occc1C(=O)N1CCN(Cc2ncc(C(C)(C)C)o2)CC1.
What is the InChIKey of [4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-(2-methylfuran-3-yl)methanone?
The InChIKey is QJASHHDNRAGCFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O3/c1-13-14(5-10-23-13)17(22)21-8-6-20(7-9-21)12-16-19-11-15(24-16)18(2,3)4/h5,10-11H,6-9,12H2,1-4H3.
What are the key properties of [4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-(2-methylfuran-3-yl)methanone?
[4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-(2-methylfuran-3-yl)methanone has a molecular weight of 331.42 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-(2-methylfuran-3-yl)methanone is sourced from PubChem (CID 56817174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).