C18H20N4OS — CID 56817678
6-[4-(4-thiophen-2-ylbutanoyl)piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 56817678) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is 6-[4-(4-thiophen-2-ylbutanoyl)piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-(4-thiophen-2-ylbutanoyl)piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 56817678 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 6-[4-(4-thiophen-2-ylbutanoyl)piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCN(C(=O)CCCc3cccs3)CC2)nc1 |
| InChI | InChI=1S/C18H20N4OS/c19-13-15-6-7-17(20-14-15)21-8-10-22(11-9-21)18(23)5-1-3-16-4-2-12-24-16/h2,4,6-7,12,14H,1,3,5,8-11H2 |
| InChIKey | STHFGPXUJCWKAQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |