About [4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]-(4-ethylpyrimidin-5-yl)methanone
[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]-(4-ethylpyrimidin-5-yl)methanone (PubChem CID 56817835) has the molecular formula C17H23N5O2
and a molecular weight of 329.40 g/mol. Its IUPAC name is [4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]-(4-ethylpyrimidin-5-yl)methanone.
Molecular Properties
| Compound Name | [4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]-(4-ethylpyrimidin-5-yl)methanone |
| PubChem CID | 56817835 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | [4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]-(4-ethylpyrimidin-5-yl)methanone |
| SMILES | CCc1ncncc1C(=O)N1CCN(Cc2c(C)noc2C)CC1 |
| InChI | InChI=1S/C17H23N5O2/c1-4-16-14(9-18-11-19-16)17(23)22-7-5-21(6-8-22)10-15-12(2)20-24-13(15)3/h9,11H,4-8,10H2,1-3H3 |
| InChIKey | VBNOOADFQHDUOY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]-(4-ethylpyrimidin-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]-(4-ethylpyrimidin-5-yl)methanone?
The IUPAC name of [4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]-(4-ethylpyrimidin-5-yl)methanone (CID 56817835) is [4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]-(4-ethylpyrimidin-5-yl)methanone.
What is the SMILES notation for [4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]-(4-ethylpyrimidin-5-yl)methanone?
The canonical SMILES for [4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]-(4-ethylpyrimidin-5-yl)methanone is CCc1ncncc1C(=O)N1CCN(Cc2c(C)noc2C)CC1.
What is the InChIKey of [4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]-(4-ethylpyrimidin-5-yl)methanone?
The InChIKey is VBNOOADFQHDUOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N5O2/c1-4-16-14(9-18-11-19-16)17(23)22-7-5-21(6-8-22)10-15-12(2)20-24-13(15)3/h9,11H,4-8,10H2,1-3H3.
What are the key properties of [4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]-(4-ethylpyrimidin-5-yl)methanone?
[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]-(4-ethylpyrimidin-5-yl)methanone has a molecular weight of 329.40 g/mol, XLogP of 1.60, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]-(4-ethylpyrimidin-5-yl)methanone is sourced from PubChem (CID 56817835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).