C18H23N3O4 — CID 56817971
2-(2-ethoxyphenoxy)-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]acetamide (PubChem CID 56817971) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-(2-ethoxyphenoxy)-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]acetamide.
| Compound Name | 2-(2-ethoxyphenoxy)-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 56817971 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-(2-ethoxyphenoxy)-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]acetamide |
| SMILES | CCOc1ccccc1OCC(=O)Nc1cnn(CC2CCCO2)c1 |
| InChI | InChI=1S/C18H23N3O4/c1-2-23-16-7-3-4-8-17(16)25-13-18(22)20-14-10-19-21(11-14)12-15-6-5-9-24-15/h3-4,7-8,10-11,15H,2,5-6,9,12-13H2,1H3,(H,20,22) |
| InChIKey | DYNLGKYWAMQQGC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |