C15H25N5O2 — CID 56818419
2-[[2-[[2-(cyclohexylmethyl)pyrazol-3-yl]amino]-2-oxoethyl]-methylamino]acetamide (PubChem CID 56818419) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 2-[[2-[[2-(cyclohexylmethyl)pyrazol-3-yl]amino]-2-oxoethyl]-methylamino]acetamide.
| Compound Name | 2-[[2-[[2-(cyclohexylmethyl)pyrazol-3-yl]amino]-2-oxoethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 56818419 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 2-[[2-[[2-(cyclohexylmethyl)pyrazol-3-yl]amino]-2-oxoethyl]-methylamino]acetamide |
| SMILES | CN(CC(N)=O)CC(=O)Nc1ccnn1CC1CCCCC1 |
| InChI | InChI=1S/C15H25N5O2/c1-19(10-13(16)21)11-15(22)18-14-7-8-17-20(14)9-12-5-3-2-4-6-12/h7-8,12H,2-6,9-11H2,1H3,(H2,16,21)(H,18,22) |
| InChIKey | XVJBFOUJKACWOT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |