C19H20F2N2O2 — CID 56818428
1-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-7-phenyl-1,4-diazepan-5-one (PubChem CID 56818428) has the molecular formula C19H20F2N2O2 and a molecular weight of 346.38 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-7-phenyl-1,4-diazepan-5-one.
| Compound Name | 1-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-7-phenyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 56818428 |
| Molecular Formula | C19H20F2N2O2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-7-phenyl-1,4-diazepan-5-one |
| SMILES | O=C1CC(c2ccccc2)N(CC(O)c2ccc(F)c(F)c2)CCN1 |
| InChI | InChI=1S/C19H20F2N2O2/c20-15-7-6-14(10-16(15)21)18(24)12-23-9-8-22-19(25)11-17(23)13-4-2-1-3-5-13/h1-7,10,17-18,24H,8-9,11-12H2,(H,22,25) |
| InChIKey | GIRHFAWEBMNQIV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |