C20H20N4O — CID 56818493
1-(3-methylphenyl)-N-[(6-pyrazol-1-yl-3-pyridinyl)methyl]cyclopropane-1-carboxamide (PubChem CID 56818493) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is 1-(3-methylphenyl)-N-[(6-pyrazol-1-yl-3-pyridinyl)methyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(3-methylphenyl)-N-[(6-pyrazol-1-yl-3-pyridinyl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 56818493 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 1-(3-methylphenyl)-N-[(6-pyrazol-1-yl-3-pyridinyl)methyl]cyclopropane-1-carboxamide |
| SMILES | Cc1cccc(C2(C(=O)NCc3ccc(-n4cccn4)nc3)CC2)c1 |
| InChI | InChI=1S/C20H20N4O/c1-15-4-2-5-17(12-15)20(8-9-20)19(25)22-14-16-6-7-18(21-13-16)24-11-3-10-23-24/h2-7,10-13H,8-9,14H2,1H3,(H,22,25) |
| InChIKey | AIBMADWTBFGQPU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |