About N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine
N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 56818906) has the molecular formula C18H20FN5O
and a molecular weight of 341.39 g/mol. Its IUPAC name is N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 56818906 |
| Molecular Formula | C18H20FN5O |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cn1ncc2c(NCC3(c4ccc(F)cc4)CCOCC3)ncnc21 |
| InChI | InChI=1S/C18H20FN5O/c1-24-17-15(10-23-24)16(21-12-22-17)20-11-18(6-8-25-9-7-18)13-2-4-14(19)5-3-13/h2-5,10,12H,6-9,11H2,1H3,(H,20,21,22) |
| InChIKey | YIMWWUUYCHGGPI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine (CID 56818906) is N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine is Cn1ncc2c(NCC3(c4ccc(F)cc4)CCOCC3)ncnc21.
What is the InChIKey of N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is YIMWWUUYCHGGPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FN5O/c1-24-17-15(10-23-24)16(21-12-22-17)20-11-18(6-8-25-9-7-18)13-2-4-14(19)5-3-13/h2-5,10,12H,6-9,11H2,1H3,(H,20,21,22).
What are the key properties of N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine?
N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 341.39 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 56818906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).