About 5-[(3,4-difluorophenyl)-methylsulfamoyl]thiophene-3-carboxylic acid
5-[(3,4-difluorophenyl)-methylsulfamoyl]thiophene-3-carboxylic acid (PubChem CID 56819433) has the molecular formula C12H9F2NO4S2
and a molecular weight of 333.34 g/mol. Its IUPAC name is 5-[(3,4-difluorophenyl)-methylsulfamoyl]thiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(3,4-difluorophenyl)-methylsulfamoyl]thiophene-3-carboxylic acid |
| PubChem CID | 56819433 |
| Molecular Formula | C12H9F2NO4S2 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 5-[(3,4-difluorophenyl)-methylsulfamoyl]thiophene-3-carboxylic acid |
| SMILES | CN(c1ccc(F)c(F)c1)S(=O)(=O)c1cc(C(=O)O)cs1 |
| InChI | InChI=1S/C12H9F2NO4S2/c1-15(8-2-3-9(13)10(14)5-8)21(18,19)11-4-7(6-20-11)12(16)17/h2-6H,1H3,(H,16,17) |
| InChIKey | POSCRSFZWRYJJB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3,4-difluorophenyl)-methylsulfamoyl]thiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,4-difluorophenyl)-methylsulfamoyl]thiophene-3-carboxylic acid?
The IUPAC name of 5-[(3,4-difluorophenyl)-methylsulfamoyl]thiophene-3-carboxylic acid (CID 56819433) is 5-[(3,4-difluorophenyl)-methylsulfamoyl]thiophene-3-carboxylic acid.
What is the SMILES notation for 5-[(3,4-difluorophenyl)-methylsulfamoyl]thiophene-3-carboxylic acid?
The canonical SMILES for 5-[(3,4-difluorophenyl)-methylsulfamoyl]thiophene-3-carboxylic acid is CN(c1ccc(F)c(F)c1)S(=O)(=O)c1cc(C(=O)O)cs1.
What is the InChIKey of 5-[(3,4-difluorophenyl)-methylsulfamoyl]thiophene-3-carboxylic acid?
The InChIKey is POSCRSFZWRYJJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F2NO4S2/c1-15(8-2-3-9(13)10(14)5-8)21(18,19)11-4-7(6-20-11)12(16)17/h2-6H,1H3,(H,16,17).
What are the key properties of 5-[(3,4-difluorophenyl)-methylsulfamoyl]thiophene-3-carboxylic acid?
5-[(3,4-difluorophenyl)-methylsulfamoyl]thiophene-3-carboxylic acid has a molecular weight of 333.34 g/mol, XLogP of 2.55, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-difluorophenyl)-methylsulfamoyl]thiophene-3-carboxylic acid is sourced from PubChem (CID 56819433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).