C16H19N3O2S — CID 56819945
3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(3-methylsulfanylimidazo[1,5-a]pyridin-1-yl)methanone (PubChem CID 56819945) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(3-methylsulfanylimidazo[1,5-a]pyridin-1-yl)methanone.
| Compound Name | 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(3-methylsulfanylimidazo[1,5-a]pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 56819945 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(3-methylsulfanylimidazo[1,5-a]pyridin-1-yl)methanone |
| SMILES | CSc1nc(C(=O)N2CCOC3CCCC32)c2ccccn12 |
| InChI | InChI=1S/C16H19N3O2S/c1-22-16-17-14(12-5-2-3-8-19(12)16)15(20)18-9-10-21-13-7-4-6-11(13)18/h2-3,5,8,11,13H,4,6-7,9-10H2,1H3 |
| InChIKey | VBXFJWHECVVJOX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |