C16H23N5O — CID 56820200
1-(4-methylpiperidin-1-yl)-3-(5-phenyltetrazol-2-yl)propan-2-ol (PubChem CID 56820200) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-(4-methylpiperidin-1-yl)-3-(5-phenyltetrazol-2-yl)propan-2-ol.
| Compound Name | 1-(4-methylpiperidin-1-yl)-3-(5-phenyltetrazol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 56820200 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 1-(4-methylpiperidin-1-yl)-3-(5-phenyltetrazol-2-yl)propan-2-ol |
| SMILES | CC1CCN(CC(O)Cn2nnc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C16H23N5O/c1-13-7-9-20(10-8-13)11-15(22)12-21-18-16(17-19-21)14-5-3-2-4-6-14/h2-6,13,15,22H,7-12H2,1H3 |
| InChIKey | QVFGYWABTKLKOH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |