C14H14N4O4 — CID 56820586
2-[(1-methoxyisoquinoline-3-carbonyl)amino]propanediamide (PubChem CID 56820586) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is 2-[(1-methoxyisoquinoline-3-carbonyl)amino]propanediamide.
| Compound Name | 2-[(1-methoxyisoquinoline-3-carbonyl)amino]propanediamide |
|---|---|
| PubChem CID | 56820586 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-[(1-methoxyisoquinoline-3-carbonyl)amino]propanediamide |
| SMILES | COc1nc(C(=O)NC(C(N)=O)C(N)=O)cc2ccccc12 |
| InChI | InChI=1S/C14H14N4O4/c1-22-14-8-5-3-2-4-7(8)6-9(17-14)13(21)18-10(11(15)19)12(16)20/h2-6,10H,1H3,(H2,15,19)(H2,16,20)(H,18,21) |
| InChIKey | QTLIGXOIQOWGHY-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 137.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|