C18H20N2O2 — CID 56820894
5-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one (PubChem CID 56820894) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 5-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one.
| Compound Name | 5-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 56820894 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 5-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
| SMILES | O=c1ccc2c([nH]1)CCCC2NCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C18H20N2O2/c21-18-7-5-14-15(2-1-3-16(14)20-18)19-11-12-4-6-17-13(10-12)8-9-22-17/h4-7,10,15,19H,1-3,8-9,11H2,(H,20,21) |
| InChIKey | YGXNOQMXZLVLQD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|