About ethyl 4-oxo-5-phenylpentanoate
ethyl 4-oxo-5-phenylpentanoate (PubChem CID 568213) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is ethyl 4-oxo-5-phenylpentanoate.
Molecular Properties
| Compound Name | ethyl 4-oxo-5-phenylpentanoate |
| PubChem CID | 568213 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | ethyl 4-oxo-5-phenylpentanoate |
| SMILES | CCOC(=O)CCC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C13H16O3/c1-2-16-13(15)9-8-12(14)10-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3 |
| InChIKey | ORGPSJHOOQCAES-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-oxo-5-phenylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-oxo-5-phenylpentanoate?
The IUPAC name of ethyl 4-oxo-5-phenylpentanoate (CID 568213) is ethyl 4-oxo-5-phenylpentanoate.
What is the SMILES notation for ethyl 4-oxo-5-phenylpentanoate?
The canonical SMILES for ethyl 4-oxo-5-phenylpentanoate is CCOC(=O)CCC(=O)Cc1ccccc1.
What is the InChIKey of ethyl 4-oxo-5-phenylpentanoate?
The InChIKey is ORGPSJHOOQCAES-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-2-16-13(15)9-8-12(14)10-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3.
What are the key properties of ethyl 4-oxo-5-phenylpentanoate?
ethyl 4-oxo-5-phenylpentanoate has a molecular weight of 220.27 g/mol, XLogP of 2.14, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-oxo-5-phenylpentanoate is sourced from PubChem (CID 568213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).