C11H18O3 — CID 568217
5-methoxy-3,4,4,6-tetramethyl-7-oxabicyclo[4.1.0]heptan-2-one (PubChem CID 568217) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 5-methoxy-3,4,4,6-tetramethyl-7-oxabicyclo[4.1.0]heptan-2-one.
| Compound Name | 5-methoxy-3,4,4,6-tetramethyl-7-oxabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 568217 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 5-methoxy-3,4,4,6-tetramethyl-7-oxabicyclo[4.1.0]heptan-2-one |
| SMILES | COC1C(C)(C)C(C)C(=O)C2OC21C |
| InChI | InChI=1S/C11H18O3/c1-6-7(12)8-11(4,14-8)9(13-5)10(6,2)3/h6,8-9H,1-5H3 |
| InChIKey | QOHIMWOTZMZAMK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|