C18H25N3O2 — CID 56821816
1-(1-benzylpiperidine-3-carbonyl)-1,4-diazepan-5-one (PubChem CID 56821816) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 1-(1-benzylpiperidine-3-carbonyl)-1,4-diazepan-5-one.
| Compound Name | 1-(1-benzylpiperidine-3-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 56821816 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 1-(1-benzylpiperidine-3-carbonyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)C2CCCN(Cc3ccccc3)C2)CCN1 |
| InChI | InChI=1S/C18H25N3O2/c22-17-8-11-21(12-9-19-17)18(23)16-7-4-10-20(14-16)13-15-5-2-1-3-6-15/h1-3,5-6,16H,4,7-14H2,(H,19,22) |
| InChIKey | LBJUFXNGASZSKH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |