C14H20F3N3O2 — CID 56822829
5,5-dicyclopropyl-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]imidazolidine-2,4-dione (PubChem CID 56822829) has the molecular formula C14H20F3N3O2 and a molecular weight of 319.33 g/mol. Its IUPAC name is 5,5-dicyclopropyl-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dicyclopropyl-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56822829 |
| Molecular Formula | C14H20F3N3O2 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 5,5-dicyclopropyl-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]imidazolidine-2,4-dione |
| SMILES | CCN(CN1C(=O)NC(C2CC2)(C2CC2)C1=O)CC(F)(F)F |
| InChI | InChI=1S/C14H20F3N3O2/c1-2-19(7-13(15,16)17)8-20-11(21)14(9-3-4-9,10-5-6-10)18-12(20)22/h9-10H,2-8H2,1H3,(H,18,22) |
| InChIKey | WKXIXPZFWZQFPW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|