About N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methoxyacetamide
N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methoxyacetamide (PubChem CID 56823152) has the molecular formula C11H18N2O2S
and a molecular weight of 242.34 g/mol. Its IUPAC name is N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methoxyacetamide.
Molecular Properties
| Compound Name | N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methoxyacetamide |
| PubChem CID | 56823152 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methoxyacetamide |
| SMILES | CCc1nc(CCNC(=O)COC)sc1C |
| InChI | InChI=1S/C11H18N2O2S/c1-4-9-8(2)16-11(13-9)5-6-12-10(14)7-15-3/h4-7H2,1-3H3,(H,12,14) |
| InChIKey | LTMWXMVDMJYLMY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methoxyacetamide?
The IUPAC name of N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methoxyacetamide (CID 56823152) is N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methoxyacetamide.
What is the SMILES notation for N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methoxyacetamide?
The canonical SMILES for N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methoxyacetamide is CCc1nc(CCNC(=O)COC)sc1C.
What is the InChIKey of N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methoxyacetamide?
The InChIKey is LTMWXMVDMJYLMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2S/c1-4-9-8(2)16-11(13-9)5-6-12-10(14)7-15-3/h4-7H2,1-3H3,(H,12,14).
What are the key properties of N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methoxyacetamide?
N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methoxyacetamide has a molecular weight of 242.34 g/mol, XLogP of 1.32, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methoxyacetamide is sourced from PubChem (CID 56823152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).