About 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-methylurea
1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-methylurea (PubChem CID 56823204) has the molecular formula C10H17N3OS
and a molecular weight of 227.33 g/mol. Its IUPAC name is 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-methylurea.
Molecular Properties
| Compound Name | 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-methylurea |
| PubChem CID | 56823204 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-methylurea |
| SMILES | CCc1nc(CCNC(=O)NC)sc1C |
| InChI | InChI=1S/C10H17N3OS/c1-4-8-7(2)15-9(13-8)5-6-12-10(14)11-3/h4-6H2,1-3H3,(H2,11,12,14) |
| InChIKey | XNCVSPGFQQSOOQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-methylurea?
The IUPAC name of 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-methylurea (CID 56823204) is 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-methylurea.
What is the SMILES notation for 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-methylurea?
The canonical SMILES for 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-methylurea is CCc1nc(CCNC(=O)NC)sc1C.
What is the InChIKey of 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-methylurea?
The InChIKey is XNCVSPGFQQSOOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3OS/c1-4-8-7(2)15-9(13-8)5-6-12-10(14)11-3/h4-6H2,1-3H3,(H2,11,12,14).
What are the key properties of 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-methylurea?
1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-methylurea has a molecular weight of 227.33 g/mol, XLogP of 1.49, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-methylurea is sourced from PubChem (CID 56823204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).