About 1-amino-2,3-diphenylpropan-2-ol
1-amino-2,3-diphenylpropan-2-ol (PubChem CID 56823265) has the molecular formula C15H17NO
and a molecular weight of 227.31 g/mol. Its IUPAC name is 1-amino-2,3-diphenylpropan-2-ol.
Molecular Properties
| Compound Name | 1-amino-2,3-diphenylpropan-2-ol |
| PubChem CID | 56823265 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 1-amino-2,3-diphenylpropan-2-ol |
| SMILES | NCC(O)(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H17NO/c16-12-15(17,14-9-5-2-6-10-14)11-13-7-3-1-4-8-13/h1-10,17H,11-12,16H2 |
| InChIKey | SWLPAKNOXOHUIJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-amino-2,3-diphenylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2,3-diphenylpropan-2-ol?
The IUPAC name of 1-amino-2,3-diphenylpropan-2-ol (CID 56823265) is 1-amino-2,3-diphenylpropan-2-ol.
What is the SMILES notation for 1-amino-2,3-diphenylpropan-2-ol?
The canonical SMILES for 1-amino-2,3-diphenylpropan-2-ol is NCC(O)(Cc1ccccc1)c1ccccc1.
What is the InChIKey of 1-amino-2,3-diphenylpropan-2-ol?
The InChIKey is SWLPAKNOXOHUIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO/c16-12-15(17,14-9-5-2-6-10-14)11-13-7-3-1-4-8-13/h1-10,17H,11-12,16H2.
What are the key properties of 1-amino-2,3-diphenylpropan-2-ol?
1-amino-2,3-diphenylpropan-2-ol has a molecular weight of 227.31 g/mol, XLogP of 2.08, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2,3-diphenylpropan-2-ol is sourced from PubChem (CID 56823265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).